C21H28N10O — CID 59333573
5-[9-(cyclopropylmethyl)-6-morpholin-4-yl-8-piperazin-1-ylpurin-2-yl]pyrimidin-2-amine (PubChem CID 59333573) has the molecular formula C21H28N10O and a molecular weight of 436.52 g/mol. Its IUPAC name is 5-[9-(cyclopropylmethyl)-6-morpholin-4-yl-8-piperazin-1-ylpurin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[9-(cyclopropylmethyl)-6-morpholin-4-yl-8-piperazin-1-ylpurin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59333573 |
| Molecular Formula | C21H28N10O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 5-[9-(cyclopropylmethyl)-6-morpholin-4-yl-8-piperazin-1-ylpurin-2-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3nc(N4CCNCC4)n(CC4CC4)c3n2)cn1 |
| InChI | InChI=1S/C21H28N10O/c22-20-24-11-15(12-25-20)17-27-18(29-7-9-32-10-8-29)16-19(28-17)31(13-14-1-2-14)21(26-16)30-5-3-23-4-6-30/h11-12,14,23H,1-10,13H2,(H2,22,24,25) |
| InChIKey | LFGYZIILKDIEIV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |