C17H19ClIN8O+ — CID 163486817
[2-amino-5-[8-chloro-9-(cyclopropylmethyl)-6-morpholin-4-ylpurin-2-yl]pyrimidin-4-yl]iodanium (PubChem CID 163486817) has the molecular formula C17H19ClIN8O+ and a molecular weight of 513.75 g/mol. Its IUPAC name is [2-amino-5-[8-chloro-9-(cyclopropylmethyl)-6-morpholin-4-ylpurin-2-yl]pyrimidin-4-yl]iodanium.
| Compound Name | [2-amino-5-[8-chloro-9-(cyclopropylmethyl)-6-morpholin-4-ylpurin-2-yl]pyrimidin-4-yl]iodanium |
|---|---|
| PubChem CID | 163486817 |
| Molecular Formula | C17H19ClIN8O+ |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | [2-amino-5-[8-chloro-9-(cyclopropylmethyl)-6-morpholin-4-ylpurin-2-yl]pyrimidin-4-yl]iodanium |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3nc(Cl)n(CC4CC4)c3n2)c([IH+])n1 |
| InChI | InChI=1S/C17H19ClIN8O/c18-16-22-11-14(26-3-5-28-6-4-26)24-13(10-7-21-17(20)23-12(10)19)25-15(11)27(16)8-9-1-2-9/h7,9,19H,1-6,8H2,(H2,20,21,23)/q+1 |
| InChIKey | CJFWJCXRXNXJPY-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|