C18H20ClN7O — CID 141266183
4-[8-chloro-9-(cyclopropylmethyl)-2-(4-methylpyrimidin-5-yl)purin-6-yl]morpholine (PubChem CID 141266183) has the molecular formula C18H20ClN7O and a molecular weight of 385.86 g/mol. Its IUPAC name is 4-[8-chloro-9-(cyclopropylmethyl)-2-(4-methylpyrimidin-5-yl)purin-6-yl]morpholine.
| Compound Name | 4-[8-chloro-9-(cyclopropylmethyl)-2-(4-methylpyrimidin-5-yl)purin-6-yl]morpholine |
|---|---|
| PubChem CID | 141266183 |
| Molecular Formula | C18H20ClN7O |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[8-chloro-9-(cyclopropylmethyl)-2-(4-methylpyrimidin-5-yl)purin-6-yl]morpholine |
| SMILES | Cc1ncncc1-c1nc(N2CCOCC2)c2nc(Cl)n(CC3CC3)c2n1 |
| InChI | InChI=1S/C18H20ClN7O/c1-11-13(8-20-10-21-11)15-23-16(25-4-6-27-7-5-25)14-17(24-15)26(18(19)22-14)9-12-2-3-12/h8,10,12H,2-7,9H2,1H3 |
| InChIKey | WPYPEPQBTIEKIT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |