C24H20Cl2N2O2 — CID 89146166
(4R)-1-[3-(1-aminoethenyl)phenyl]-4-[4-chloro-3-(2-chlorophenoxy)phenyl]pyrrolidin-2-one (PubChem CID 89146166) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is (4R)-1-[3-(1-aminoethenyl)phenyl]-4-[4-chloro-3-(2-chlorophenoxy)phenyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-[3-(1-aminoethenyl)phenyl]-4-[4-chloro-3-(2-chlorophenoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 89146166 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (4R)-1-[3-(1-aminoethenyl)phenyl]-4-[4-chloro-3-(2-chlorophenoxy)phenyl]pyrrolidin-2-one |
| SMILES | C=C(N)c1cccc(N2C[C@@H](c3ccc(Cl)c(Oc4ccccc4Cl)c3)CC2=O)c1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-15(27)16-5-4-6-19(11-16)28-14-18(13-24(28)29)17-9-10-21(26)23(12-17)30-22-8-3-2-7-20(22)25/h2-12,18H,1,13-14,27H2/t18-/m0/s1 |
| InChIKey | RDLGYKBKBYUXRV-SFHVURJKSA-N |
| XLogP | 6.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |