C25H26N4O2 — CID 89146173
(4R)-4-[4-amino-3-(2-amino-6-methylphenoxy)phenyl]-1-[3-(1-aminoethenyl)phenyl]pyrrolidin-2-one (PubChem CID 89146173) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (4R)-4-[4-amino-3-(2-amino-6-methylphenoxy)phenyl]-1-[3-(1-aminoethenyl)phenyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[4-amino-3-(2-amino-6-methylphenoxy)phenyl]-1-[3-(1-aminoethenyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 89146173 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (4R)-4-[4-amino-3-(2-amino-6-methylphenoxy)phenyl]-1-[3-(1-aminoethenyl)phenyl]pyrrolidin-2-one |
| SMILES | C=C(N)c1cccc(N2C[C@@H](c3ccc(N)c(Oc4c(C)cccc4N)c3)CC2=O)c1 |
| InChI | InChI=1S/C25H26N4O2/c1-15-5-3-8-22(28)25(15)31-23-12-18(9-10-21(23)27)19-13-24(30)29(14-19)20-7-4-6-17(11-20)16(2)26/h3-12,19H,2,13-14,26-28H2,1H3/t19-/m0/s1 |
| InChIKey | QOLBZNFEVMVWHP-IBGZPJMESA-N |
| XLogP | 4.40 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|