C58H40N4 — CID 89146424
2-[7-(4,6-diphenylpyrimidin-2-yl)-2'-[(1Z,3Z)-penta-1,3-dienyl]spiro[fluorene-9,1'-indene]-2-yl]-4,6-diphenylpyrimidine (PubChem CID 89146424) has the molecular formula C58H40N4 and a molecular weight of 792.99 g/mol. Its IUPAC name is 2-[7-(4,6-diphenylpyrimidin-2-yl)-2'-[(1Z,3Z)-penta-1,3-dienyl]spiro[fluorene-9,1'-indene]-2-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[7-(4,6-diphenylpyrimidin-2-yl)-2'-[(1Z,3Z)-penta-1,3-dienyl]spiro[fluorene-9,1'-indene]-2-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 89146424 |
| Molecular Formula | C58H40N4 |
| Molecular Weight | 792.99 g/mol |
| Exact Mass | 792.33 |
| IUPAC Name | 2-[7-(4,6-diphenylpyrimidin-2-yl)-2'-[(1Z,3Z)-penta-1,3-dienyl]spiro[fluorene-9,1'-indene]-2-yl]-4,6-diphenylpyrimidine |
| SMILES | C/C=C\C=C/C1=Cc2ccccc2C12c1cc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)ccc1-c1ccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc12 |
| InChI | InChI=1S/C58H40N4/c1-2-3-8-28-46-34-43-27-17-18-29-49(43)58(46)50-35-44(56-59-52(39-19-9-4-10-20-39)37-53(60-56)40-21-11-5-12-22-40)30-32-47(50)48-33-31-45(36-51(48)58)57-61-54(41-23-13-6-14-24-41)38-55(62-57)42-25-15-7-16-26-42/h2-38H,1H3/b3-2-,28-8- |
| InChIKey | VNZWIPQFZXIXRE-KLZTXGNNSA-N |
| XLogP | 14.11 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.99 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|