C23H23FN2O4 — CID 89147439
2-fluoro-N-(2-formyl-1,7-dimethylindol-6-yl)-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 89147439) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-fluoro-N-(2-formyl-1,7-dimethylindol-6-yl)-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | 2-fluoro-N-(2-formyl-1,7-dimethylindol-6-yl)-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 89147439 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-fluoro-N-(2-formyl-1,7-dimethylindol-6-yl)-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(OC[C@@H]3CCCO3)cc2F)ccc2cc(C=O)n(C)c12 |
| InChI | InChI=1S/C23H23FN2O4/c1-14-21(8-5-15-10-16(12-27)26(2)22(14)15)25-23(28)19-7-6-17(11-20(19)24)30-13-18-4-3-9-29-18/h5-8,10-12,18H,3-4,9,13H2,1-2H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | BVUCMJUUQAICBR-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|