C27H33N3O3 — CID 58083280
N-[8-methyl-3-[(2-methylpropylamino)methyl]quinolin-7-yl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 58083280) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[8-methyl-3-[(2-methylpropylamino)methyl]quinolin-7-yl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[8-methyl-3-[(2-methylpropylamino)methyl]quinolin-7-yl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 58083280 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-[8-methyl-3-[(2-methylpropylamino)methyl]quinolin-7-yl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(OCC3CCCO3)cc2)ccc2cc(CNCC(C)C)cnc12 |
| InChI | InChI=1S/C27H33N3O3/c1-18(2)14-28-15-20-13-22-8-11-25(19(3)26(22)29-16-20)30-27(31)21-6-9-23(10-7-21)33-17-24-5-4-12-32-24/h6-11,13,16,18,24,28H,4-5,12,14-15,17H2,1-3H3,(H,30,31) |
| InChIKey | KUIIIQBVSNNPPL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |