C28H33N3O2S — CID 58111661
4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide (PubChem CID 58111661) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is 4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide.
| Compound Name | 4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 58111661 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(OCCC3CC3)cc2)ccc2cc(CNC3CCSCC3)cnc12 |
| InChI | InChI=1S/C28H33N3O2S/c1-19-26(31-28(32)22-4-7-25(8-5-22)33-13-10-20-2-3-20)9-6-23-16-21(18-30-27(19)23)17-29-24-11-14-34-15-12-24/h4-9,16,18,20,24,29H,2-3,10-15,17H2,1H3,(H,31,32) |
| InChIKey | DSRDJDQBUGYJKB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |