C27H33N3O2S — CID 58111630
4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(3-methylsulfanylpropylamino)methyl]quinolin-7-yl]benzamide (PubChem CID 58111630) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is 4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(3-methylsulfanylpropylamino)methyl]quinolin-7-yl]benzamide.
| Compound Name | 4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(3-methylsulfanylpropylamino)methyl]quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 58111630 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 4-(2-cyclopropylethoxy)-N-[8-methyl-3-[(3-methylsulfanylpropylamino)methyl]quinolin-7-yl]benzamide |
| SMILES | CSCCCNCc1cnc2c(C)c(NC(=O)c3ccc(OCCC4CC4)cc3)ccc2c1 |
| InChI | InChI=1S/C27H33N3O2S/c1-19-25(11-8-23-16-21(18-29-26(19)23)17-28-13-3-15-33-2)30-27(31)22-6-9-24(10-7-22)32-14-12-20-4-5-20/h6-11,16,18,20,28H,3-5,12-15,17H2,1-2H3,(H,30,31) |
| InChIKey | AUAOJMPCURIVOP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|