C27H31F2N3O4S — CID 58111701
4-(cyclopropylmethoxy)-N-[3-[[3-(1,1-difluoroethylsulfonyl)propylamino]methyl]-8-methylquinolin-7-yl]benzamide (PubChem CID 58111701) has the molecular formula C27H31F2N3O4S and a molecular weight of 531.63 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-N-[3-[[3-(1,1-difluoroethylsulfonyl)propylamino]methyl]-8-methylquinolin-7-yl]benzamide.
| Compound Name | 4-(cyclopropylmethoxy)-N-[3-[[3-(1,1-difluoroethylsulfonyl)propylamino]methyl]-8-methylquinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 58111701 |
| Molecular Formula | C27H31F2N3O4S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 4-(cyclopropylmethoxy)-N-[3-[[3-(1,1-difluoroethylsulfonyl)propylamino]methyl]-8-methylquinolin-7-yl]benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(OCC3CC3)cc2)ccc2cc(CNCCCS(=O)(=O)C(C)(F)F)cnc12 |
| InChI | InChI=1S/C27H31F2N3O4S/c1-18-24(32-26(33)21-6-9-23(10-7-21)36-17-19-4-5-19)11-8-22-14-20(16-31-25(18)22)15-30-12-3-13-37(34,35)27(2,28)29/h6-11,14,16,19,30H,3-5,12-13,15,17H2,1-2H3,(H,32,33) |
| InChIKey | AXKCEHUCUJZGDE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|