C26H28FN3O2S — CID 58111660
4-(cyclopropylmethoxy)-N-[8-fluoro-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide (PubChem CID 58111660) has the molecular formula C26H28FN3O2S and a molecular weight of 465.59 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-N-[8-fluoro-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide.
| Compound Name | 4-(cyclopropylmethoxy)-N-[8-fluoro-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 58111660 |
| Molecular Formula | C26H28FN3O2S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-(cyclopropylmethoxy)-N-[8-fluoro-3-[(thian-4-ylamino)methyl]quinolin-7-yl]benzamide |
| SMILES | O=C(Nc1ccc2cc(CNC3CCSCC3)cnc2c1F)c1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C26H28FN3O2S/c27-24-23(30-26(31)19-3-6-22(7-4-19)32-16-17-1-2-17)8-5-20-13-18(15-29-25(20)24)14-28-21-9-11-33-12-10-21/h3-8,13,15,17,21,28H,1-2,9-12,14,16H2,(H,30,31) |
| InChIKey | AJPUNMIFTFWFAW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |