C29H37ClO2 — CID 89147648
(8R,9S,10R,13S,14S)-16-[[3-(3-chloropropoxy)phenyl]methylidene]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 89147648) has the molecular formula C29H37ClO2 and a molecular weight of 453.07 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-16-[[3-(3-chloropropoxy)phenyl]methylidene]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-16-[[3-(3-chloropropoxy)phenyl]methylidene]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 89147648 |
| Molecular Formula | C29H37ClO2 |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (8R,9S,10R,13S,14S)-16-[[3-(3-chloropropoxy)phenyl]methylidene]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCCC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C(=Cc3cccc(OCCCCl)c3)C[C@@H]12 |
| InChI | InChI=1S/C29H37ClO2/c1-28-13-4-3-8-22(28)10-11-24-25(28)12-14-29(2)26(24)19-21(27(29)31)17-20-7-5-9-23(18-20)32-16-6-15-30/h5,7,9-10,17-18,24-26H,3-4,6,8,11-16,19H2,1-2H3/t24-,25+,26+,28+,29+/m1/s1 |
| InChIKey | YOSZMBJGGVTJPX-MWCUFWALSA-N |
| XLogP | 7.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|