C26H33ClN4O3 — CID 89149008
2-(4-chlorophenoxy)-N-[8-[5-[1-(2-methoxyethylamino)ethenyl]-2-pyridinyl]-8-azabicyclo[3.2.1]octan-3-yl]propanamide (PubChem CID 89149008) has the molecular formula C26H33ClN4O3 and a molecular weight of 485.03 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[8-[5-[1-(2-methoxyethylamino)ethenyl]-2-pyridinyl]-8-azabicyclo[3.2.1]octan-3-yl]propanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[8-[5-[1-(2-methoxyethylamino)ethenyl]-2-pyridinyl]-8-azabicyclo[3.2.1]octan-3-yl]propanamide |
|---|---|
| PubChem CID | 89149008 |
| Molecular Formula | C26H33ClN4O3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[8-[5-[1-(2-methoxyethylamino)ethenyl]-2-pyridinyl]-8-azabicyclo[3.2.1]octan-3-yl]propanamide |
| SMILES | C=C(NCCOC)c1ccc(N2C3CCC2CC(NC(=O)C(C)Oc2ccc(Cl)cc2)C3)nc1 |
| InChI | InChI=1S/C26H33ClN4O3/c1-17(28-12-13-33-3)19-4-11-25(29-16-19)31-22-7-8-23(31)15-21(14-22)30-26(32)18(2)34-24-9-5-20(27)6-10-24/h4-6,9-11,16,18,21-23,28H,1,7-8,12-15H2,2-3H3,(H,30,32) |
| InChIKey | OOBAYXMVVWAWHH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|