C21H16N2O2 — CID 89150925
[(Z)-(2-imino-1,2-diphenylethylidene)amino] benzoate (PubChem CID 89150925) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is [(Z)-(2-imino-1,2-diphenylethylidene)amino] benzoate.
| Compound Name | [(Z)-(2-imino-1,2-diphenylethylidene)amino] benzoate |
|---|---|
| PubChem CID | 89150925 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(Z)-(2-imino-1,2-diphenylethylidene)amino] benzoate |
| SMILES | [H]/N=C(C(=N\OC(=O)c1ccccc1)/c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C21H16N2O2/c22-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)23-25-21(24)18-14-8-3-9-15-18/h1-15,22H/b22-19+,23-20- |
| InChIKey | KQFCCQOLMGEGOX-JMALZQNKSA-N |
| XLogP | 4.32 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|