C14H20O — CID 89151077
(E,2R)-5-(3-ethylphenyl)-2-methylpent-4-en-1-ol (PubChem CID 89151077) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (E,2R)-5-(3-ethylphenyl)-2-methylpent-4-en-1-ol.
| Compound Name | (E,2R)-5-(3-ethylphenyl)-2-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 89151077 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (E,2R)-5-(3-ethylphenyl)-2-methylpent-4-en-1-ol |
| SMILES | CCc1cccc(/C=C/C[C@@H](C)CO)c1 |
| InChI | InChI=1S/C14H20O/c1-3-13-7-5-9-14(10-13)8-4-6-12(2)11-15/h4-5,7-10,12,15H,3,6,11H2,1-2H3/b8-4+/t12-/m1/s1 |
| InChIKey | BBNRFGIJHBZWQO-WNPFHQFXSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |