C14H20O — CID 89151080
(E)-4-(3-ethylphenyl)-2,2-dimethylbut-3-en-1-ol (PubChem CID 89151080) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (E)-4-(3-ethylphenyl)-2,2-dimethylbut-3-en-1-ol.
| Compound Name | (E)-4-(3-ethylphenyl)-2,2-dimethylbut-3-en-1-ol |
|---|---|
| PubChem CID | 89151080 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (E)-4-(3-ethylphenyl)-2,2-dimethylbut-3-en-1-ol |
| SMILES | CCc1cccc(/C=C/C(C)(C)CO)c1 |
| InChI | InChI=1S/C14H20O/c1-4-12-6-5-7-13(10-12)8-9-14(2,3)11-15/h5-10,15H,4,11H2,1-3H3/b9-8+ |
| InChIKey | BEMDNIZJXBLVCJ-CMDGGOBGSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |