C7H6N2O3S — CID 89153761
5-(oxiran-2-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 89153761) has the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. Its IUPAC name is 5-(oxiran-2-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(oxiran-2-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 89153761 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 5-(oxiran-2-ylmethylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=CC1CO1 |
| InChI | InChI=1S/C7H6N2O3S/c10-5-4(1-3-2-12-3)6(11)9-7(13)8-5/h1,3H,2H2,(H2,8,9,10,11,13) |
| InChIKey | QIZKRTJPEHYVKV-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|