C26H24ClN3O4 — CID 89154517
2-[5-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylpentanoic acid (PubChem CID 89154517) has the molecular formula C26H24ClN3O4 and a molecular weight of 477.95 g/mol. Its IUPAC name is 2-[5-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylpentanoic acid.
| Compound Name | 2-[5-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 89154517 |
| Molecular Formula | C26H24ClN3O4 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[5-[4-[(2-chloropyridine-3-carbonyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)C(C(=O)O)N1Cc2ccc(-c3ccc(NC(=O)c4cccnc4Cl)cc3)cc2C1=O |
| InChI | InChI=1S/C26H24ClN3O4/c1-3-15(2)22(26(33)34)30-14-18-7-6-17(13-21(18)25(30)32)16-8-10-19(11-9-16)29-24(31)20-5-4-12-28-23(20)27/h4-13,15,22H,3,14H2,1-2H3,(H,29,31)(H,33,34) |
| InChIKey | MMDKGTKKXCXBAQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|