C19H15N3O5 — CID 89154568
(3Z,5E)-3,5-bis[(2-nitrophenyl)methylidene]piperidin-4-one (PubChem CID 89154568) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(2-nitrophenyl)methylidene]piperidin-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(2-nitrophenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 89154568 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (3Z,5E)-3,5-bis[(2-nitrophenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C\c2ccccc2[N+](=O)[O-])CNC/C1=C\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N3O5/c23-19-15(9-13-5-1-3-7-17(13)21(24)25)11-20-12-16(19)10-14-6-2-4-8-18(14)22(26)27/h1-10,20H,11-12H2/b15-9-,16-10+ |
| InChIKey | YACSEYUCBSJOIQ-CKOAPEAFSA-N |
| XLogP | 3.14 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|