C24H26ClFN2O — CID 89155021
N-[1-[1-(3-chlorophenyl)piperidin-4-yl]ethenyl]-2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]aniline (PubChem CID 89155021) has the molecular formula C24H26ClFN2O and a molecular weight of 412.94 g/mol. Its IUPAC name is N-[1-[1-(3-chlorophenyl)piperidin-4-yl]ethenyl]-2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]aniline.
| Compound Name | N-[1-[1-(3-chlorophenyl)piperidin-4-yl]ethenyl]-2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 89155021 |
| Molecular Formula | C24H26ClFN2O |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[1-[1-(3-chlorophenyl)piperidin-4-yl]ethenyl]-2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]aniline |
| SMILES | C=C(/C=C/c1cccc(F)c1NC(=C)C1CCN(c2cccc(Cl)c2)CC1)OC |
| InChI | InChI=1S/C24H26ClFN2O/c1-17(29-3)10-11-20-6-4-9-23(26)24(20)27-18(2)19-12-14-28(15-13-19)22-8-5-7-21(25)16-22/h4-11,16,19,27H,1-2,12-15H2,3H3/b11-10+ |
| InChIKey | CEGQMZRPXRHVST-ZHACJKMWSA-N |
| XLogP | 6.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|