C24H27FN2O2 — CID 89155136
N-[2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]phenyl]-1-(3-methylphenyl)piperidine-4-carboxamide (PubChem CID 89155136) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]phenyl]-1-(3-methylphenyl)piperidine-4-carboxamide.
| Compound Name | N-[2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]phenyl]-1-(3-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 89155136 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-[2-fluoro-6-[(1E)-3-methoxybuta-1,3-dienyl]phenyl]-1-(3-methylphenyl)piperidine-4-carboxamide |
| SMILES | C=C(/C=C/c1cccc(F)c1NC(=O)C1CCN(c2cccc(C)c2)CC1)OC |
| InChI | InChI=1S/C24H27FN2O2/c1-17-6-4-8-21(16-17)27-14-12-20(13-15-27)24(28)26-23-19(7-5-9-22(23)25)11-10-18(2)29-3/h4-11,16,20H,2,12-15H2,1,3H3,(H,26,28)/b11-10+ |
| InChIKey | LIMUIHFQZBXZQG-ZHACJKMWSA-N |
| XLogP | 5.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|