C12H14ClIN2O2 — CID 89155887
(2S,4R)-N-(4-chlorophenyl)-2-iodo-4-methoxypyrrolidine-1-carboxamide (PubChem CID 89155887) has the molecular formula C12H14ClIN2O2 and a molecular weight of 380.61 g/mol. Its IUPAC name is (2S,4R)-N-(4-chlorophenyl)-2-iodo-4-methoxypyrrolidine-1-carboxamide.
| Compound Name | (2S,4R)-N-(4-chlorophenyl)-2-iodo-4-methoxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 89155887 |
| Molecular Formula | C12H14ClIN2O2 |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | (2S,4R)-N-(4-chlorophenyl)-2-iodo-4-methoxypyrrolidine-1-carboxamide |
| SMILES | CO[C@@H]1C[C@H](I)N(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C12H14ClIN2O2/c1-18-10-6-11(14)16(7-10)12(17)15-9-4-2-8(13)3-5-9/h2-5,10-11H,6-7H2,1H3,(H,15,17)/t10-,11-/m1/s1 |
| InChIKey | UYIKPPOGKVLRCJ-GHMZBOCLSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|