C28H34FN3O4 — CID 89159746
N-cyclopropyl-3-[2-[4-(ethylamino)-4-oxobutoxy]-4-(2-methylprop-2-enylcarbamoyl)phenyl]-5-fluoro-4-methylbenzamide (PubChem CID 89159746) has the molecular formula C28H34FN3O4 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-cyclopropyl-3-[2-[4-(ethylamino)-4-oxobutoxy]-4-(2-methylprop-2-enylcarbamoyl)phenyl]-5-fluoro-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[2-[4-(ethylamino)-4-oxobutoxy]-4-(2-methylprop-2-enylcarbamoyl)phenyl]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 89159746 |
| Molecular Formula | C28H34FN3O4 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-cyclopropyl-3-[2-[4-(ethylamino)-4-oxobutoxy]-4-(2-methylprop-2-enylcarbamoyl)phenyl]-5-fluoro-4-methylbenzamide |
| SMILES | C=C(C)CNC(=O)c1ccc(-c2cc(C(=O)NC3CC3)cc(F)c2C)c(OCCCC(=O)NCC)c1 |
| InChI | InChI=1S/C28H34FN3O4/c1-5-30-26(33)7-6-12-36-25-15-19(27(34)31-16-17(2)3)8-11-22(25)23-13-20(14-24(29)18(23)4)28(35)32-21-9-10-21/h8,11,13-15,21H,2,5-7,9-10,12,16H2,1,3-4H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | AEDQFCIYOIFHQH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|