C22H26FN3O2 — CID 135283535
6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-pentylpyridine-3-carboxamide (PubChem CID 135283535) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-pentylpyridine-3-carboxamide.
| Compound Name | 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-pentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 135283535 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-pentylpyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc(-c2cc(C(=O)NC3CC3)cc(F)c2C)nc1 |
| InChI | InChI=1S/C22H26FN3O2/c1-3-4-5-10-24-21(27)15-6-9-20(25-13-15)18-11-16(12-19(23)14(18)2)22(28)26-17-7-8-17/h6,9,11-13,17H,3-5,7-8,10H2,1-2H3,(H,24,27)(H,26,28) |
| InChIKey | KMSHHGSIQUSRJP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|