About N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane
N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane (PubChem CID 142273840) has the molecular formula C26H35FN2O2
and a molecular weight of 426.58 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane.
Molecular Properties
| Compound Name | N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane |
| PubChem CID | 142273840 |
| Molecular Formula | C26H35FN2O2 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane |
| SMILES | CCC(=O)C1=CC=C(c2cc(C(=O)NC3CC3)cc(F)c2C)N=CC1.CCCCCC |
| InChI | InChI=1S/C20H21FN2O2.C6H14/c1-3-19(24)13-4-7-18(22-9-8-13)16-10-14(11-17(21)12(16)2)20(25)23-15-5-6-15;1-3-5-6-4-2/h4,7,9-11,15H,3,5-6,8H2,1-2H3,(H,23,25);3-6H2,1-2H3 |
| InChIKey | AXYWBDNYTWIJLM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane?
The IUPAC name of N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane (CID 142273840) is N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane.
What is the SMILES notation for N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane?
The canonical SMILES for N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane is CCC(=O)C1=CC=C(c2cc(C(=O)NC3CC3)cc(F)c2C)N=CC1.CCCCCC.
What is the InChIKey of N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane?
The InChIKey is AXYWBDNYTWIJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O2.C6H14/c1-3-19(24)13-4-7-18(22-9-8-13)16-10-14(11-17(21)12(16)2)20(25)23-15-5-6-15;1-3-5-6-4-2/h4,7,9-11,15H,3,5-6,8H2,1-2H3,(H,23,25);3-6H2,1-2H3.
What are the key properties of N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane?
N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane has a molecular weight of 426.58 g/mol, XLogP of 6.33, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3-fluoro-4-methyl-5-(4-propanoyl-3H-azepin-7-yl)benzamide;hexane is sourced from PubChem (CID 142273840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).