C29H35FN4O3 — CID 159050930
N-cyclopropyl-3-fluoro-4-methyl-5-[2-oxo-3-[2-(2-pentoxyphenyl)propan-2-ylamino]pyrazin-1-yl]benzamide (PubChem CID 159050930) has the molecular formula C29H35FN4O3 and a molecular weight of 506.62 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-4-methyl-5-[2-oxo-3-[2-(2-pentoxyphenyl)propan-2-ylamino]pyrazin-1-yl]benzamide.
| Compound Name | N-cyclopropyl-3-fluoro-4-methyl-5-[2-oxo-3-[2-(2-pentoxyphenyl)propan-2-ylamino]pyrazin-1-yl]benzamide |
|---|---|
| PubChem CID | 159050930 |
| Molecular Formula | C29H35FN4O3 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N-cyclopropyl-3-fluoro-4-methyl-5-[2-oxo-3-[2-(2-pentoxyphenyl)propan-2-ylamino]pyrazin-1-yl]benzamide |
| SMILES | CCCCCOc1ccccc1C(C)(C)Nc1nccn(-c2cc(C(=O)NC3CC3)cc(F)c2C)c1=O |
| InChI | InChI=1S/C29H35FN4O3/c1-5-6-9-16-37-25-11-8-7-10-22(25)29(3,4)33-26-28(36)34(15-14-31-26)24-18-20(17-23(30)19(24)2)27(35)32-21-12-13-21/h7-8,10-11,14-15,17-18,21H,5-6,9,12-13,16H2,1-4H3,(H,31,33)(H,32,35) |
| InChIKey | JXGHCGAWZXNHAW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|