C34H39N5O5 — CID 66689897
benzyl N-[3-[2-[2-[[4-[5-(ethylcarbamoyl)-2-methylphenyl]-3-oxopyrazin-2-yl]amino]propan-2-yl]phenoxy]propyl]carbamate (PubChem CID 66689897) has the molecular formula C34H39N5O5 and a molecular weight of 597.72 g/mol. Its IUPAC name is benzyl N-[3-[2-[2-[[4-[5-(ethylcarbamoyl)-2-methylphenyl]-3-oxopyrazin-2-yl]amino]propan-2-yl]phenoxy]propyl]carbamate.
| Compound Name | benzyl N-[3-[2-[2-[[4-[5-(ethylcarbamoyl)-2-methylphenyl]-3-oxopyrazin-2-yl]amino]propan-2-yl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 66689897 |
| Molecular Formula | C34H39N5O5 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | benzyl N-[3-[2-[2-[[4-[5-(ethylcarbamoyl)-2-methylphenyl]-3-oxopyrazin-2-yl]amino]propan-2-yl]phenoxy]propyl]carbamate |
| SMILES | CCNC(=O)c1ccc(C)c(-n2ccnc(NC(C)(C)c3ccccc3OCCCNC(=O)OCc3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C34H39N5O5/c1-5-35-31(40)26-17-16-24(2)28(22-26)39-20-19-36-30(32(39)41)38-34(3,4)27-14-9-10-15-29(27)43-21-11-18-37-33(42)44-23-25-12-7-6-8-13-25/h6-10,12-17,19-20,22H,5,11,18,21,23H2,1-4H3,(H,35,40)(H,36,38)(H,37,42) |
| InChIKey | KZBHYZFMBMAGPG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|