C6H11ClN2 — CID 89160444
3-(chloromethyl)-2,5-dimethyl-3,4-dihydropyrazole (PubChem CID 89160444) has the molecular formula C6H11ClN2 and a molecular weight of 146.62 g/mol. Its IUPAC name is 3-(chloromethyl)-2,5-dimethyl-3,4-dihydropyrazole.
| Compound Name | 3-(chloromethyl)-2,5-dimethyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 89160444 |
| Molecular Formula | C6H11ClN2 |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 3-(chloromethyl)-2,5-dimethyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(C)C(CCl)C1 |
| InChI | InChI=1S/C6H11ClN2/c1-5-3-6(4-7)9(2)8-5/h6H,3-4H2,1-2H3 |
| InChIKey | RKBCSWIWLCPIJI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|