C7H13Cl2N — CID 10997656
(2S,5R)-2,5-bis(chloromethyl)-1-methylpyrrolidine (PubChem CID 10997656) has the molecular formula C7H13Cl2N and a molecular weight of 182.09 g/mol. Its IUPAC name is (2S,5R)-2,5-bis(chloromethyl)-1-methylpyrrolidine.
| Compound Name | (2S,5R)-2,5-bis(chloromethyl)-1-methylpyrrolidine |
|---|---|
| PubChem CID | 10997656 |
| Molecular Formula | C7H13Cl2N |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | (2S,5R)-2,5-bis(chloromethyl)-1-methylpyrrolidine |
| SMILES | CN1[C@H](CCl)CC[C@@H]1CCl |
| InChI | InChI=1S/C7H13Cl2N/c1-10-6(4-8)2-3-7(10)5-9/h6-7H,2-5H2,1H3/t6-,7+ |
| InChIKey | VEWFTIYGIGHENL-KNVOCYPGSA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|