C7H15NO — CID 90247444
[(5R)-1,5-dimethylpyrrolidin-2-yl]methanol (PubChem CID 90247444) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol.
| Compound Name | [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 90247444 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol |
| SMILES | C[C@@H]1CCC(CO)N1C |
| InChI | InChI=1S/C7H15NO/c1-6-3-4-7(5-9)8(6)2/h6-7,9H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | TWWGXIKLLGUFCD-ULUSZKPHSA-N |
| XLogP | 0.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |