About [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol
[(5R)-1,5-dimethylpyrrolidin-2-yl]methanol (PubChem CID 90247444) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol |
| PubChem CID | 90247444 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol |
| SMILES | C[C@@H]1CCC(CO)N1C |
| InChI | InChI=1S/C7H15NO/c1-6-3-4-7(5-9)8(6)2/h6-7,9H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | TWWGXIKLLGUFCD-ULUSZKPHSA-N |
| XLogP | 0.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol?
The IUPAC name of [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol (CID 90247444) is [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol is C[C@@H]1CCC(CO)N1C.
What is the InChIKey of [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol?
The InChIKey is TWWGXIKLLGUFCD-ULUSZKPHSA-N. The full InChI is InChI=1S/C7H15NO/c1-6-3-4-7(5-9)8(6)2/h6-7,9H,3-5H2,1-2H3/t6-,7?/m1/s1.
What are the key properties of [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol?
[(5R)-1,5-dimethylpyrrolidin-2-yl]methanol has a molecular weight of 129.20 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-1,5-dimethylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 90247444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).