C7H11ClN2O — CID 146362261
(2S)-2-(chloromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 146362261) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is (2S)-2-(chloromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S)-2-(chloromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 146362261 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (2S)-2-(chloromethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1NC2CC[C@@H](CCl)N1C2 |
| InChI | InChI=1S/C7H11ClN2O/c8-3-6-2-1-5-4-10(6)7(11)9-5/h5-6H,1-4H2,(H,9,11)/t5?,6-/m0/s1 |
| InChIKey | TZHMZRZGPKDMOX-GDVGLLTNSA-N |
| XLogP | 0.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|