C7H11N3O2 — CID 134172897
(2R)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 134172897) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is (2R)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2R)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 134172897 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2R)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCC2CN1C(=O)N2 |
| InChI | InChI=1S/C7H11N3O2/c8-6(11)5-2-1-4-3-10(5)7(12)9-4/h4-5H,1-3H2,(H2,8,11)(H,9,12)/t4?,5-/m1/s1 |
| InChIKey | AOERXOCCTLXMMH-BRJRFNKRSA-N |
| XLogP | -0.97 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |