C8H13ClN2O — CID 131075460
3-(chloromethyl)-1,4-diazabicyclo[3.2.2]nonan-2-one (PubChem CID 131075460) has the molecular formula C8H13ClN2O and a molecular weight of 188.66 g/mol. Its IUPAC name is 3-(chloromethyl)-1,4-diazabicyclo[3.2.2]nonan-2-one.
| Compound Name | 3-(chloromethyl)-1,4-diazabicyclo[3.2.2]nonan-2-one |
|---|---|
| PubChem CID | 131075460 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-(chloromethyl)-1,4-diazabicyclo[3.2.2]nonan-2-one |
| SMILES | O=C1C(CCl)NC2CCN1CC2 |
| InChI | InChI=1S/C8H13ClN2O/c9-5-7-8(12)11-3-1-6(10-7)2-4-11/h6-7,10H,1-5H2 |
| InChIKey | DYYBFPICTUSUKX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|