C19H17N5O2 — CID 89160829
3-[5-amino-4-[1-[(3,4-dihydroxyphenyl)methylamino]ethenyl]pyrazol-1-yl]benzonitrile (PubChem CID 89160829) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 3-[5-amino-4-[1-[(3,4-dihydroxyphenyl)methylamino]ethenyl]pyrazol-1-yl]benzonitrile.
| Compound Name | 3-[5-amino-4-[1-[(3,4-dihydroxyphenyl)methylamino]ethenyl]pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 89160829 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[5-amino-4-[1-[(3,4-dihydroxyphenyl)methylamino]ethenyl]pyrazol-1-yl]benzonitrile |
| SMILES | C=C(NCc1ccc(O)c(O)c1)c1cnn(-c2cccc(C#N)c2)c1N |
| InChI | InChI=1S/C19H17N5O2/c1-12(22-10-14-5-6-17(25)18(26)8-14)16-11-23-24(19(16)21)15-4-2-3-13(7-15)9-20/h2-8,11,22,25-26H,1,10,21H2 |
| InChIKey | SSAHVPRNONAKCE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|