C20H22N6O2 — CID 89162964
2-[[5-amino-2-(4-amino-2-methoxyanilino)-4-pyridinyl]amino]-N-methylbenzamide (PubChem CID 89162964) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[[5-amino-2-(4-amino-2-methoxyanilino)-4-pyridinyl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-amino-2-(4-amino-2-methoxyanilino)-4-pyridinyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 89162964 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[[5-amino-2-(4-amino-2-methoxyanilino)-4-pyridinyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Nc1cc(Nc2ccc(N)cc2OC)ncc1N |
| InChI | InChI=1S/C20H22N6O2/c1-23-20(27)13-5-3-4-6-15(13)25-17-10-19(24-11-14(17)22)26-16-8-7-12(21)9-18(16)28-2/h3-11H,21-22H2,1-2H3,(H,23,27)(H2,24,25,26) |
| InChIKey | VTPVWZBXDPLSBQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|