C26H28N6O3S — CID 58155179
2-[[5-isocyano-2-[2-methoxy-4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)anilino]-4-pyridinyl]amino]-N-methylbenzamide (PubChem CID 58155179) has the molecular formula C26H28N6O3S and a molecular weight of 504.62 g/mol. Its IUPAC name is 2-[[5-isocyano-2-[2-methoxy-4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)anilino]-4-pyridinyl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-isocyano-2-[2-methoxy-4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)anilino]-4-pyridinyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 58155179 |
| Molecular Formula | C26H28N6O3S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 2-[[5-isocyano-2-[2-methoxy-4-(1-methylidene-1-oxo-1,4-thiazinan-4-yl)anilino]-4-pyridinyl]amino]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1cnc(Nc2ccc(N3CCS(=C)(=O)CC3)cc2OC)cc1Nc1ccccc1C(=O)NC |
| InChI | InChI=1S/C26H28N6O3S/c1-27-23-17-29-25(16-22(23)30-20-8-6-5-7-19(20)26(33)28-2)31-21-10-9-18(15-24(21)35-3)32-11-13-36(4,34)14-12-32/h5-10,15-17H,4,11-14H2,2-3H3,(H,28,33)(H2,29,30,31) |
| InChIKey | IKUFPYSJPPCJFI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|