C23H47NO — CID 89163872
N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-pentylbutanamide (PubChem CID 89163872) has the molecular formula C23H47NO and a molecular weight of 353.64 g/mol. Its IUPAC name is N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-pentylbutanamide.
| Compound Name | N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-pentylbutanamide |
|---|---|
| PubChem CID | 89163872 |
| Molecular Formula | C23H47NO |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 353.37 |
| IUPAC Name | N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-pentylbutanamide |
| SMILES | CCCCCN(C(=O)CCC)C(CC(C)(CC)CC)C(C)(CC)CC |
| InChI | InChI=1S/C23H47NO/c1-9-15-16-18-24(21(25)17-10-2)20(23(8,13-5)14-6)19-22(7,11-3)12-4/h20H,9-19H2,1-8H3 |
| InChIKey | HSIDLYKFVQLBBY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|