C24H49NO — CID 89171165
N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-methylnonanamide (PubChem CID 89171165) has the molecular formula C24H49NO and a molecular weight of 367.66 g/mol. Its IUPAC name is N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-methylnonanamide.
| Compound Name | N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-methylnonanamide |
|---|---|
| PubChem CID | 89171165 |
| Molecular Formula | C24H49NO |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 367.38 |
| IUPAC Name | N-(3,6-diethyl-3,6-dimethyloctan-4-yl)-N-methylnonanamide |
| SMILES | CCCCCCCCC(=O)N(C)C(CC(C)(CC)CC)C(C)(CC)CC |
| InChI | InChI=1S/C24H49NO/c1-9-14-15-16-17-18-19-22(26)25(8)21(24(7,12-4)13-5)20-23(6,10-2)11-3/h21H,9-20H2,1-8H3 |
| InChIKey | JOOQFIVAZJNJGN-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|