C27H34N3O3S+ — CID 89171906
S-[2-[[2-[(5E)-5-[[4-(3-hydroxy-4-methylpyrrolidin-1-yl)phenyl]methylidene]-7,8-dihydro-6H-isoquinolin-2-ium-2-yl]acetyl]amino]ethyl] ethanethioate (PubChem CID 89171906) has the molecular formula C27H34N3O3S+ and a molecular weight of 480.65 g/mol. Its IUPAC name is S-[2-[[2-[(5E)-5-[[4-(3-hydroxy-4-methylpyrrolidin-1-yl)phenyl]methylidene]-7,8-dihydro-6H-isoquinolin-2-ium-2-yl]acetyl]amino]ethyl] ethanethioate.
| Compound Name | S-[2-[[2-[(5E)-5-[[4-(3-hydroxy-4-methylpyrrolidin-1-yl)phenyl]methylidene]-7,8-dihydro-6H-isoquinolin-2-ium-2-yl]acetyl]amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 89171906 |
| Molecular Formula | C27H34N3O3S+ |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | S-[2-[[2-[(5E)-5-[[4-(3-hydroxy-4-methylpyrrolidin-1-yl)phenyl]methylidene]-7,8-dihydro-6H-isoquinolin-2-ium-2-yl]acetyl]amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCNC(=O)C[n+]1ccc2c(c1)CCC/C2=C\c1ccc(N2CC(C)C(O)C2)cc1 |
| InChI | InChI=1S/C27H33N3O3S/c1-19-15-30(17-26(19)32)24-8-6-21(7-9-24)14-22-4-3-5-23-16-29(12-10-25(22)23)18-27(33)28-11-13-34-20(2)31/h6-10,12,14,16,19,26,32H,3-5,11,13,15,17-18H2,1-2H3/p+1 |
| InChIKey | KXXMYTYIXIJLMJ-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 73.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|