C6H12BNO2 — CID 89172400
CID 89172400 (PubChem CID 89172400) has the molecular formula C6H12BNO2 and a molecular weight of 140.98 g/mol.
| Compound Name | CID 89172400 |
|---|---|
| PubChem CID | 89172400 |
| Molecular Formula | C6H12BNO2 |
| Molecular Weight | 140.98 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | — |
| SMILES | [B]C(CNC(C)C)C(=O)O |
| InChI | InChI=1S/C6H12BNO2/c1-4(2)8-3-5(7)6(9)10/h4-5,8H,3H2,1-2H3,(H,9,10) |
| InChIKey | HFQBFCMLDFJYPG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.98 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|