About (Z)-2,3-dimethoxybut-2-enedial
(Z)-2,3-dimethoxybut-2-enedial (PubChem CID 89174688) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is (Z)-2,3-dimethoxybut-2-enedial.
Molecular Properties
| Compound Name | (Z)-2,3-dimethoxybut-2-enedial |
| PubChem CID | 89174688 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (Z)-2,3-dimethoxybut-2-enedial |
| SMILES | CO/C(C=O)=C(/C=O)OC |
| InChI | InChI=1S/C6H8O4/c1-9-5(3-7)6(4-8)10-2/h3-4H,1-2H3/b6-5- |
| InChIKey | XARWFZMHODMVSB-WAYWQWQTSA-N |
| XLogP | -0.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dimethoxybut-2-enedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dimethoxybut-2-enedial?
The IUPAC name of (Z)-2,3-dimethoxybut-2-enedial (CID 89174688) is (Z)-2,3-dimethoxybut-2-enedial.
What is the SMILES notation for (Z)-2,3-dimethoxybut-2-enedial?
The canonical SMILES for (Z)-2,3-dimethoxybut-2-enedial is CO/C(C=O)=C(/C=O)OC.
What is the InChIKey of (Z)-2,3-dimethoxybut-2-enedial?
The InChIKey is XARWFZMHODMVSB-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H8O4/c1-9-5(3-7)6(4-8)10-2/h3-4H,1-2H3/b6-5-.
What are the key properties of (Z)-2,3-dimethoxybut-2-enedial?
(Z)-2,3-dimethoxybut-2-enedial has a molecular weight of 144.13 g/mol, XLogP of -0.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dimethoxybut-2-enedial is sourced from PubChem (CID 89174688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).