C9H16N2O2 — CID 144683567
(2E,4Z)-2-(aminomethyl)-3-methoxy-5-(methylamino)hexa-2,4-dienal (PubChem CID 144683567) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2E,4Z)-2-(aminomethyl)-3-methoxy-5-(methylamino)hexa-2,4-dienal.
| Compound Name | (2E,4Z)-2-(aminomethyl)-3-methoxy-5-(methylamino)hexa-2,4-dienal |
|---|---|
| PubChem CID | 144683567 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2E,4Z)-2-(aminomethyl)-3-methoxy-5-(methylamino)hexa-2,4-dienal |
| SMILES | CN/C(C)=C\C(OC)=C(/C=O)CN |
| InChI | InChI=1S/C9H16N2O2/c1-7(11-2)4-9(13-3)8(5-10)6-12/h4,6,11H,5,10H2,1-3H3/b7-4-,9-8+ |
| InChIKey | NLLPDXNTBYAGKP-NKUJDFQBSA-N |
| XLogP | 0.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|