C26H27BClN3O4S — CID 89175209
CID 89175209 (PubChem CID 89175209) has the molecular formula C26H27BClN3O4S and a molecular weight of 523.85 g/mol.
| Compound Name | CID 89175209 |
|---|---|
| PubChem CID | 89175209 |
| Molecular Formula | C26H27BClN3O4S |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | — |
| SMILES | [B]C(CS)NC(=O)C1CCCN1C(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(CO)cc12 |
| InChI | InChI=1S/C26H27BClN3O4S/c1-15-19(12-24(33)30-10-2-3-22(30)25(34)29-23(27)14-36)20-11-16(13-32)4-9-21(20)31(15)26(35)17-5-7-18(28)8-6-17/h4-9,11,22-23,32,36H,2-3,10,12-14H2,1H3,(H,29,34) |
| InChIKey | UJLNSVWSOVQHJG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|