C28H31ClN2O3 — CID 162283280
N-[5-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-4-oxopentyl]cyclopentanecarboxamide (PubChem CID 162283280) has the molecular formula C28H31ClN2O3 and a molecular weight of 479.02 g/mol. Its IUPAC name is N-[5-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-4-oxopentyl]cyclopentanecarboxamide.
| Compound Name | N-[5-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-4-oxopentyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 162283280 |
| Molecular Formula | C28H31ClN2O3 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[5-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-4-oxopentyl]cyclopentanecarboxamide |
| SMILES | Cc1ccc2c(c1)c(CC(=O)CCCNC(=O)C1CCCC1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H31ClN2O3/c1-18-9-14-26-25(16-18)24(19(2)31(26)28(34)21-10-12-22(29)13-11-21)17-23(32)8-5-15-30-27(33)20-6-3-4-7-20/h9-14,16,20H,3-8,15,17H2,1-2H3,(H,30,33) |
| InChIKey | DXQROGBNLDHIHY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|