C24H20ClNO — CID 11211027
(3-benzyl-2,5-dimethylindol-1-yl)-(4-chlorophenyl)methanone (PubChem CID 11211027) has the molecular formula C24H20ClNO and a molecular weight of 373.88 g/mol. Its IUPAC name is (3-benzyl-2,5-dimethylindol-1-yl)-(4-chlorophenyl)methanone.
| Compound Name | (3-benzyl-2,5-dimethylindol-1-yl)-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 11211027 |
| Molecular Formula | C24H20ClNO |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (3-benzyl-2,5-dimethylindol-1-yl)-(4-chlorophenyl)methanone |
| SMILES | Cc1ccc2c(c1)c(Cc1ccccc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClNO/c1-16-8-13-23-22(14-16)21(15-18-6-4-3-5-7-18)17(2)26(23)24(27)19-9-11-20(25)12-10-19/h3-14H,15H2,1-2H3 |
| InChIKey | IZPSFGAYWFYLHR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |