C42H49ClN2O4 — CID 158058008
(2Z,4E,6E,8E)-N-[5-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-oxopentyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 158058008) has the molecular formula C42H49ClN2O4 and a molecular weight of 681.32 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-N-[5-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-oxopentyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2Z,4E,6E,8E)-N-[5-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-oxopentyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 158058008 |
| Molecular Formula | C42H49ClN2O4 |
| Molecular Weight | 681.32 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | (2Z,4E,6E,8E)-N-[5-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-oxopentyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)CCCNC(=O)/C=C(C)\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C42H49ClN2O4/c1-28(15-21-38-30(3)13-9-23-42(38,5)6)11-8-12-29(2)25-40(47)44-24-10-14-34(46)26-36-31(4)45(39-22-20-35(49-7)27-37(36)39)41(48)32-16-18-33(43)19-17-32/h8,11-12,15-22,25,27H,9-10,13-14,23-24,26H2,1-7H3,(H,44,47)/b12-8+,21-15+,28-11+,29-25- |
| InChIKey | RCNHDNMYGGFSCI-TVUBIIFKSA-N |
| XLogP | 9.84 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.32 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|