C41H48ClN3O5 — CID 89313097
2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2E,4E,6E,8E)-2-amino-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 89313097) has the molecular formula C41H48ClN3O5 and a molecular weight of 698.30 g/mol. Its IUPAC name is 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2E,4E,6E,8E)-2-amino-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2E,4E,6E,8E)-2-amino-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 89313097 |
| Molecular Formula | C41H48ClN3O5 |
| Molecular Weight | 698.30 g/mol |
| Exact Mass | 697.33 |
| IUPAC Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2E,4E,6E,8E)-2-amino-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCOC(=O)/C(N)=C(C)\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C41H48ClN3O5/c1-26(13-19-35-27(2)12-9-21-41(35,5)6)10-8-11-28(3)38(43)40(48)50-23-22-44-37(46)25-33-29(4)45(36-20-18-32(49-7)24-34(33)36)39(47)30-14-16-31(42)17-15-30/h8,10-11,13-20,24H,9,12,21-23,25,43H2,1-7H3,(H,44,46)/b11-8+,19-13+,26-10+,38-28+ |
| InChIKey | TUXYIXOWFRVWGS-HWNPNXKGSA-N |
| XLogP | 8.32 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.30 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|