C32H27ClN2O5 — CID 158515561
2-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-N-[4-oxo-4-(2-oxochromen-3-yl)butyl]acetamide (PubChem CID 158515561) has the molecular formula C32H27ClN2O5 and a molecular weight of 555.03 g/mol. Its IUPAC name is 2-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-N-[4-oxo-4-(2-oxochromen-3-yl)butyl]acetamide.
| Compound Name | 2-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-N-[4-oxo-4-(2-oxochromen-3-yl)butyl]acetamide |
|---|---|
| PubChem CID | 158515561 |
| Molecular Formula | C32H27ClN2O5 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 2-[1-(4-chlorobenzoyl)-2,5-dimethylindol-3-yl]-N-[4-oxo-4-(2-oxochromen-3-yl)butyl]acetamide |
| SMILES | Cc1ccc2c(c1)c(CC(=O)NCCCC(=O)c1cc3ccccc3oc1=O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H27ClN2O5/c1-19-9-14-27-25(16-19)24(20(2)35(27)31(38)21-10-12-23(33)13-11-21)18-30(37)34-15-5-7-28(36)26-17-22-6-3-4-8-29(22)40-32(26)39/h3-4,6,8-14,16-17H,5,7,15,18H2,1-2H3,(H,34,37) |
| InChIKey | HLOVDZJIRIESCT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|