C22H28N4O6S — CID 89175219
N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1-methylindole-2-carboxamide (PubChem CID 89175219) has the molecular formula C22H28N4O6S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1-methylindole-2-carboxamide.
| Compound Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 89175219 |
| Molecular Formula | C22H28N4O6S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1-methylindole-2-carboxamide |
| SMILES | COc1c(NC(=O)c2cc3cccc(N(O)O)c3n2C)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C22H28N4O6S/c1-22(2,3)14-11-15(20(32-5)16(12-14)24-33(6,30)31)23-21(27)18-10-13-8-7-9-17(26(28)29)19(13)25(18)4/h7-12,24,28-29H,1-6H3,(H,23,27) |
| InChIKey | GJBAKZXRGPIPRY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|